C22H42O8 — CID 139746819
2-methylpentan-2-yloxy 6-(2,4,4-trimethylpentan-2-ylperoxycarbonyloxy)hexyl carbonate (PubChem CID 139746819) has the molecular formula C22H42O8 and a molecular weight of 434.57 g/mol. Its IUPAC name is 2-methylpentan-2-yloxy 6-(2,4,4-trimethylpentan-2-ylperoxycarbonyloxy)hexyl carbonate.
| Compound Name | 2-methylpentan-2-yloxy 6-(2,4,4-trimethylpentan-2-ylperoxycarbonyloxy)hexyl carbonate |
|---|---|
| PubChem CID | 139746819 |
| Molecular Formula | C22H42O8 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 2-methylpentan-2-yloxy 6-(2,4,4-trimethylpentan-2-ylperoxycarbonyloxy)hexyl carbonate |
| SMILES | CCCC(C)(C)OOC(=O)OCCCCCCOC(=O)OOC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C22H42O8/c1-9-14-21(5,6)29-27-18(23)25-15-12-10-11-13-16-26-19(24)28-30-22(7,8)17-20(2,3)4/h9-17H2,1-8H3 |
| InChIKey | OHUSHEJPKQKAJQ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|