C30H58O13 — CID 18913350
(5-tert-butylperoxy-2,5-dimethylhexan-2-yl)oxy 2-[2-(5-tert-butylperoxy-2,5-dimethylhexan-2-yl)peroxycarbonyloxyethoxy]ethyl carbonate (PubChem CID 18913350) has the molecular formula C30H58O13 and a molecular weight of 626.78 g/mol. Its IUPAC name is (5-tert-butylperoxy-2,5-dimethylhexan-2-yl)oxy 2-[2-(5-tert-butylperoxy-2,5-dimethylhexan-2-yl)peroxycarbonyloxyethoxy]ethyl carbonate.
| Compound Name | (5-tert-butylperoxy-2,5-dimethylhexan-2-yl)oxy 2-[2-(5-tert-butylperoxy-2,5-dimethylhexan-2-yl)peroxycarbonyloxyethoxy]ethyl carbonate |
|---|---|
| PubChem CID | 18913350 |
| Molecular Formula | C30H58O13 |
| Molecular Weight | 626.78 g/mol |
| Exact Mass | 626.39 |
| IUPAC Name | (5-tert-butylperoxy-2,5-dimethylhexan-2-yl)oxy 2-[2-(5-tert-butylperoxy-2,5-dimethylhexan-2-yl)peroxycarbonyloxyethoxy]ethyl carbonate |
| SMILES | CC(C)(C)OOC(C)(C)CCC(C)(C)OOC(=O)OCCOCCOC(=O)OOC(C)(C)CCC(C)(C)OOC(C)(C)C |
| InChI | InChI=1S/C30H58O13/c1-25(2,3)38-42-29(11,12)17-15-27(7,8)40-36-23(31)34-21-19-33-20-22-35-24(32)37-41-28(9,10)16-18-30(13,14)43-39-26(4,5)6/h15-22H2,1-14H3 |
| InChIKey | LLXYLWJARLRPPT-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 135.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.78 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|