About 2-methylheptan-2-yloxy 2-(2-methylheptan-2-ylperoxycarbonyloxy)ethyl carbonate
2-methylheptan-2-yloxy 2-(2-methylheptan-2-ylperoxycarbonyloxy)ethyl carbonate (PubChem CID 21289257) has the molecular formula C20H38O8
and a molecular weight of 406.52 g/mol. Its IUPAC name is 2-methylheptan-2-yloxy 2-(2-methylheptan-2-ylperoxycarbonyloxy)ethyl carbonate.
Molecular Properties
| Compound Name | 2-methylheptan-2-yloxy 2-(2-methylheptan-2-ylperoxycarbonyloxy)ethyl carbonate |
| PubChem CID | 21289257 |
| Molecular Formula | C20H38O8 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 2-methylheptan-2-yloxy 2-(2-methylheptan-2-ylperoxycarbonyloxy)ethyl carbonate |
| SMILES | CCCCCC(C)(C)OOC(=O)OCCOC(=O)OOC(C)(C)CCCCC |
| InChI | InChI=1S/C20H38O8/c1-7-9-11-13-19(3,4)27-25-17(21)23-15-16-24-18(22)26-28-20(5,6)14-12-10-8-2/h7-16H2,1-6H3 |
| InChIKey | LKUZFWGHATYFMP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylheptan-2-yloxy 2-(2-methylheptan-2-ylperoxycarbonyloxy)ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylheptan-2-yloxy 2-(2-methylheptan-2-ylperoxycarbonyloxy)ethyl carbonate?
The IUPAC name of 2-methylheptan-2-yloxy 2-(2-methylheptan-2-ylperoxycarbonyloxy)ethyl carbonate (CID 21289257) is 2-methylheptan-2-yloxy 2-(2-methylheptan-2-ylperoxycarbonyloxy)ethyl carbonate.
What is the SMILES notation for 2-methylheptan-2-yloxy 2-(2-methylheptan-2-ylperoxycarbonyloxy)ethyl carbonate?
The canonical SMILES for 2-methylheptan-2-yloxy 2-(2-methylheptan-2-ylperoxycarbonyloxy)ethyl carbonate is CCCCCC(C)(C)OOC(=O)OCCOC(=O)OOC(C)(C)CCCCC.
What is the InChIKey of 2-methylheptan-2-yloxy 2-(2-methylheptan-2-ylperoxycarbonyloxy)ethyl carbonate?
The InChIKey is LKUZFWGHATYFMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O8/c1-7-9-11-13-19(3,4)27-25-17(21)23-15-16-24-18(22)26-28-20(5,6)14-12-10-8-2/h7-16H2,1-6H3.
What are the key properties of 2-methylheptan-2-yloxy 2-(2-methylheptan-2-ylperoxycarbonyloxy)ethyl carbonate?
2-methylheptan-2-yloxy 2-(2-methylheptan-2-ylperoxycarbonyloxy)ethyl carbonate has a molecular weight of 406.52 g/mol, XLogP of 5.87, 15 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylheptan-2-yloxy 2-(2-methylheptan-2-ylperoxycarbonyloxy)ethyl carbonate is sourced from PubChem (CID 21289257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).