About 2-methylhexan-2-yl nonaneperoxoate
2-methylhexan-2-yl nonaneperoxoate (PubChem CID 101276253) has the molecular formula C16H32O3
and a molecular weight of 272.43 g/mol. Its IUPAC name is 2-methylhexan-2-yl nonaneperoxoate.
Molecular Properties
| Compound Name | 2-methylhexan-2-yl nonaneperoxoate |
| PubChem CID | 101276253 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | 2-methylhexan-2-yl nonaneperoxoate |
| SMILES | CCCCCCCCC(=O)OOC(C)(C)CCCC |
| InChI | InChI=1S/C16H32O3/c1-5-7-9-10-11-12-13-15(17)18-19-16(3,4)14-8-6-2/h5-14H2,1-4H3 |
| InChIKey | GCXALOQDOGMQFZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylhexan-2-yl nonaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexan-2-yl nonaneperoxoate?
The IUPAC name of 2-methylhexan-2-yl nonaneperoxoate (CID 101276253) is 2-methylhexan-2-yl nonaneperoxoate.
What is the SMILES notation for 2-methylhexan-2-yl nonaneperoxoate?
The canonical SMILES for 2-methylhexan-2-yl nonaneperoxoate is CCCCCCCCC(=O)OOC(C)(C)CCCC.
What is the InChIKey of 2-methylhexan-2-yl nonaneperoxoate?
The InChIKey is GCXALOQDOGMQFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O3/c1-5-7-9-10-11-12-13-15(17)18-19-16(3,4)14-8-6-2/h5-14H2,1-4H3.
What are the key properties of 2-methylhexan-2-yl nonaneperoxoate?
2-methylhexan-2-yl nonaneperoxoate has a molecular weight of 272.43 g/mol, XLogP of 5.18, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexan-2-yl nonaneperoxoate is sourced from PubChem (CID 101276253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).