About 2-tert-butylperoxy-2-methylpropane;decanoyl decaneperoxoate
2-tert-butylperoxy-2-methylpropane;decanoyl decaneperoxoate (PubChem CID 174818904) has the molecular formula C28H56O6
and a molecular weight of 488.75 g/mol. Its IUPAC name is 2-tert-butylperoxy-2-methylpropane;decanoyl decaneperoxoate.
Molecular Properties
| Compound Name | 2-tert-butylperoxy-2-methylpropane;decanoyl decaneperoxoate |
| PubChem CID | 174818904 |
| Molecular Formula | C28H56O6 |
| Molecular Weight | 488.75 g/mol |
| Exact Mass | 488.41 |
| IUPAC Name | 2-tert-butylperoxy-2-methylpropane;decanoyl decaneperoxoate |
| SMILES | CC(C)(C)OOC(C)(C)C.CCCCCCCCCC(=O)OOC(=O)CCCCCCCCC |
| InChI | InChI=1S/C20H38O4.C8H18O2/c1-3-5-7-9-11-13-15-17-19(21)23-24-20(22)18-16-14-12-10-8-6-4-2;1-7(2,3)9-10-8(4,5)6/h3-18H2,1-2H3;1-6H3 |
| InChIKey | OSMYMKJOSRTHRN-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.75 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butylperoxy-2-methylpropane;decanoyl decaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylperoxy-2-methylpropane;decanoyl decaneperoxoate?
The IUPAC name of 2-tert-butylperoxy-2-methylpropane;decanoyl decaneperoxoate (CID 174818904) is 2-tert-butylperoxy-2-methylpropane;decanoyl decaneperoxoate.
What is the SMILES notation for 2-tert-butylperoxy-2-methylpropane;decanoyl decaneperoxoate?
The canonical SMILES for 2-tert-butylperoxy-2-methylpropane;decanoyl decaneperoxoate is CC(C)(C)OOC(C)(C)C.CCCCCCCCCC(=O)OOC(=O)CCCCCCCCC.
What is the InChIKey of 2-tert-butylperoxy-2-methylpropane;decanoyl decaneperoxoate?
The InChIKey is OSMYMKJOSRTHRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O4.C8H18O2/c1-3-5-7-9-11-13-15-17-19(21)23-24-20(22)18-16-14-12-10-8-6-4-2;1-7(2,3)9-10-8(4,5)6/h3-18H2,1-2H3;1-6H3.
What are the key properties of 2-tert-butylperoxy-2-methylpropane;decanoyl decaneperoxoate?
2-tert-butylperoxy-2-methylpropane;decanoyl decaneperoxoate has a molecular weight of 488.75 g/mol, XLogP of 8.80, 17 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylperoxy-2-methylpropane;decanoyl decaneperoxoate is sourced from PubChem (CID 174818904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).