About 2-ethoxyethoxycarbonyl 2-methyl-3-(2-methylpentan-2-ylperoxy)prop-2-eneperoxoate
2-ethoxyethoxycarbonyl 2-methyl-3-(2-methylpentan-2-ylperoxy)prop-2-eneperoxoate (PubChem CID 159820544) has the molecular formula C15H26O8
and a molecular weight of 334.37 g/mol. Its IUPAC name is 2-ethoxyethoxycarbonyl 2-methyl-3-(2-methylpentan-2-ylperoxy)prop-2-eneperoxoate.
Molecular Properties
| Compound Name | 2-ethoxyethoxycarbonyl 2-methyl-3-(2-methylpentan-2-ylperoxy)prop-2-eneperoxoate |
| PubChem CID | 159820544 |
| Molecular Formula | C15H26O8 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-ethoxyethoxycarbonyl 2-methyl-3-(2-methylpentan-2-ylperoxy)prop-2-eneperoxoate |
| SMILES | CCCC(C)(C)OOC=C(C)C(=O)OOC(=O)OCCOCC |
| InChI | InChI=1S/C15H26O8/c1-6-8-15(4,5)23-20-11-12(3)13(16)21-22-14(17)19-10-9-18-7-2/h11H,6-10H2,1-5H3 |
| InChIKey | NMEHJNKKFQQGEA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethoxycarbonyl 2-methyl-3-(2-methylpentan-2-ylperoxy)prop-2-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethoxycarbonyl 2-methyl-3-(2-methylpentan-2-ylperoxy)prop-2-eneperoxoate?
The IUPAC name of 2-ethoxyethoxycarbonyl 2-methyl-3-(2-methylpentan-2-ylperoxy)prop-2-eneperoxoate (CID 159820544) is 2-ethoxyethoxycarbonyl 2-methyl-3-(2-methylpentan-2-ylperoxy)prop-2-eneperoxoate.
What is the SMILES notation for 2-ethoxyethoxycarbonyl 2-methyl-3-(2-methylpentan-2-ylperoxy)prop-2-eneperoxoate?
The canonical SMILES for 2-ethoxyethoxycarbonyl 2-methyl-3-(2-methylpentan-2-ylperoxy)prop-2-eneperoxoate is CCCC(C)(C)OOC=C(C)C(=O)OOC(=O)OCCOCC.
What is the InChIKey of 2-ethoxyethoxycarbonyl 2-methyl-3-(2-methylpentan-2-ylperoxy)prop-2-eneperoxoate?
The InChIKey is NMEHJNKKFQQGEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O8/c1-6-8-15(4,5)23-20-11-12(3)13(16)21-22-14(17)19-10-9-18-7-2/h11H,6-10H2,1-5H3.
What are the key properties of 2-ethoxyethoxycarbonyl 2-methyl-3-(2-methylpentan-2-ylperoxy)prop-2-eneperoxoate?
2-ethoxyethoxycarbonyl 2-methyl-3-(2-methylpentan-2-ylperoxy)prop-2-eneperoxoate has a molecular weight of 334.37 g/mol, XLogP of 3.07, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethoxycarbonyl 2-methyl-3-(2-methylpentan-2-ylperoxy)prop-2-eneperoxoate is sourced from PubChem (CID 159820544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).