About 1-O-tert-butyl 2-O-(2-methylpentan-2-yl) ethanediperoxoate
1-O-tert-butyl 2-O-(2-methylpentan-2-yl) ethanediperoxoate (PubChem CID 54007656) has the molecular formula C12H22O6
and a molecular weight of 262.30 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-(2-methylpentan-2-yl) ethanediperoxoate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 2-O-(2-methylpentan-2-yl) ethanediperoxoate |
| PubChem CID | 54007656 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 1-O-tert-butyl 2-O-(2-methylpentan-2-yl) ethanediperoxoate |
| SMILES | CCCC(C)(C)OOC(=O)C(=O)OOC(C)(C)C |
| InChI | InChI=1S/C12H22O6/c1-7-8-12(5,6)18-16-10(14)9(13)15-17-11(2,3)4/h7-8H2,1-6H3 |
| InChIKey | KQARHZMSALTVCL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 2-O-(2-methylpentan-2-yl) ethanediperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 2-O-(2-methylpentan-2-yl) ethanediperoxoate?
The IUPAC name of 1-O-tert-butyl 2-O-(2-methylpentan-2-yl) ethanediperoxoate (CID 54007656) is 1-O-tert-butyl 2-O-(2-methylpentan-2-yl) ethanediperoxoate.
What is the SMILES notation for 1-O-tert-butyl 2-O-(2-methylpentan-2-yl) ethanediperoxoate?
The canonical SMILES for 1-O-tert-butyl 2-O-(2-methylpentan-2-yl) ethanediperoxoate is CCCC(C)(C)OOC(=O)C(=O)OOC(C)(C)C.
What is the InChIKey of 1-O-tert-butyl 2-O-(2-methylpentan-2-yl) ethanediperoxoate?
The InChIKey is KQARHZMSALTVCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O6/c1-7-8-12(5,6)18-16-10(14)9(13)15-17-11(2,3)4/h7-8H2,1-6H3.
What are the key properties of 1-O-tert-butyl 2-O-(2-methylpentan-2-yl) ethanediperoxoate?
1-O-tert-butyl 2-O-(2-methylpentan-2-yl) ethanediperoxoate has a molecular weight of 262.30 g/mol, XLogP of 2.31, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 2-O-(2-methylpentan-2-yl) ethanediperoxoate is sourced from PubChem (CID 54007656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).