C18H34O6 — CID 90779876
[2,5-dimethyl-5-(2-methylbutanoylperoxy)hexan-2-yl] 2-methylbutaneperoxoate (PubChem CID 90779876) has the molecular formula C18H34O6 and a molecular weight of 346.46 g/mol. Its IUPAC name is [2,5-dimethyl-5-(2-methylbutanoylperoxy)hexan-2-yl] 2-methylbutaneperoxoate.
| Compound Name | [2,5-dimethyl-5-(2-methylbutanoylperoxy)hexan-2-yl] 2-methylbutaneperoxoate |
|---|---|
| PubChem CID | 90779876 |
| Molecular Formula | C18H34O6 |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | [2,5-dimethyl-5-(2-methylbutanoylperoxy)hexan-2-yl] 2-methylbutaneperoxoate |
| SMILES | CCC(C)C(=O)OOC(C)(C)CCC(C)(C)OOC(=O)C(C)CC |
| InChI | InChI=1S/C18H34O6/c1-9-13(3)15(19)21-23-17(5,6)11-12-18(7,8)24-22-16(20)14(4)10-2/h13-14H,9-12H2,1-8H3 |
| InChIKey | YCWQINRJJWLSEK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|