About 3-methylbutanoyl 2-methylbutaneperoxoate
3-methylbutanoyl 2-methylbutaneperoxoate (PubChem CID 155389619) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is 3-methylbutanoyl 2-methylbutaneperoxoate.
Molecular Properties
| Compound Name | 3-methylbutanoyl 2-methylbutaneperoxoate |
| PubChem CID | 155389619 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 3-methylbutanoyl 2-methylbutaneperoxoate |
| SMILES | CCC(C)C(=O)OOC(=O)CC(C)C |
| InChI | InChI=1S/C10H18O4/c1-5-8(4)10(12)14-13-9(11)6-7(2)3/h7-8H,5-6H2,1-4H3 |
| InChIKey | WVCHHZUPGXHOBA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutanoyl 2-methylbutaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutanoyl 2-methylbutaneperoxoate?
The IUPAC name of 3-methylbutanoyl 2-methylbutaneperoxoate (CID 155389619) is 3-methylbutanoyl 2-methylbutaneperoxoate.
What is the SMILES notation for 3-methylbutanoyl 2-methylbutaneperoxoate?
The canonical SMILES for 3-methylbutanoyl 2-methylbutaneperoxoate is CCC(C)C(=O)OOC(=O)CC(C)C.
What is the InChIKey of 3-methylbutanoyl 2-methylbutaneperoxoate?
The InChIKey is WVCHHZUPGXHOBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4/c1-5-8(4)10(12)14-13-9(11)6-7(2)3/h7-8H,5-6H2,1-4H3.
What are the key properties of 3-methylbutanoyl 2-methylbutaneperoxoate?
3-methylbutanoyl 2-methylbutaneperoxoate has a molecular weight of 202.25 g/mol, XLogP of 2.08, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutanoyl 2-methylbutaneperoxoate is sourced from PubChem (CID 155389619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).