C18H34O10 — CID 21195091
[2,5-dimethyl-5-(2-methylpropoxycarbonyloxyperoxy)hexan-2-yl]peroxy 2-methylpropyl carbonate (PubChem CID 21195091) has the molecular formula C18H34O10 and a molecular weight of 410.46 g/mol. Its IUPAC name is [2,5-dimethyl-5-(2-methylpropoxycarbonyloxyperoxy)hexan-2-yl]peroxy 2-methylpropyl carbonate.
| Compound Name | [2,5-dimethyl-5-(2-methylpropoxycarbonyloxyperoxy)hexan-2-yl]peroxy 2-methylpropyl carbonate |
|---|---|
| PubChem CID | 21195091 |
| Molecular Formula | C18H34O10 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | [2,5-dimethyl-5-(2-methylpropoxycarbonyloxyperoxy)hexan-2-yl]peroxy 2-methylpropyl carbonate |
| SMILES | CC(C)COC(=O)OOOC(C)(C)CCC(C)(C)OOOC(=O)OCC(C)C |
| InChI | InChI=1S/C18H34O10/c1-13(2)11-21-15(19)23-27-25-17(5,6)9-10-18(7,8)26-28-24-16(20)22-12-14(3)4/h13-14H,9-12H2,1-8H3 |
| InChIKey | IWGWFZKVSFQXGU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|