About 2-methylpropyl propan-2-yloxy carbonate
2-methylpropyl propan-2-yloxy carbonate (PubChem CID 150489292) has the molecular formula C8H16O4
and a molecular weight of 176.21 g/mol. Its IUPAC name is 2-methylpropyl propan-2-yloxy carbonate.
Molecular Properties
| Compound Name | 2-methylpropyl propan-2-yloxy carbonate |
| PubChem CID | 150489292 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 2-methylpropyl propan-2-yloxy carbonate |
| SMILES | CC(C)COC(=O)OOC(C)C |
| InChI | InChI=1S/C8H16O4/c1-6(2)5-10-8(9)12-11-7(3)4/h6-7H,5H2,1-4H3 |
| InChIKey | HVLPBONRBPKMRD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl propan-2-yloxy carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl propan-2-yloxy carbonate?
The IUPAC name of 2-methylpropyl propan-2-yloxy carbonate (CID 150489292) is 2-methylpropyl propan-2-yloxy carbonate.
What is the SMILES notation for 2-methylpropyl propan-2-yloxy carbonate?
The canonical SMILES for 2-methylpropyl propan-2-yloxy carbonate is CC(C)COC(=O)OOC(C)C.
What is the InChIKey of 2-methylpropyl propan-2-yloxy carbonate?
The InChIKey is HVLPBONRBPKMRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O4/c1-6(2)5-10-8(9)12-11-7(3)4/h6-7H,5H2,1-4H3.
What are the key properties of 2-methylpropyl propan-2-yloxy carbonate?
2-methylpropyl propan-2-yloxy carbonate has a molecular weight of 176.21 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl propan-2-yloxy carbonate is sourced from PubChem (CID 150489292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).