About bis(propan-2-yl 2-methylpropaneperoxoate);zirconium
bis(propan-2-yl 2-methylpropaneperoxoate);zirconium (PubChem CID 88861451) has the molecular formula C14H28O6Zr
and a molecular weight of 383.60 g/mol. Its IUPAC name is bis(propan-2-yl 2-methylpropaneperoxoate);zirconium.
Molecular Properties
| Compound Name | bis(propan-2-yl 2-methylpropaneperoxoate);zirconium |
| PubChem CID | 88861451 |
| Molecular Formula | C14H28O6Zr |
| Molecular Weight | 383.60 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | bis(propan-2-yl 2-methylpropaneperoxoate);zirconium |
| SMILES | CC(C)OOC(=O)C(C)C.CC(C)OOC(=O)C(C)C.[Zr] |
| InChI | InChI=1S/2C7H14O3.Zr/c2*1-5(2)7(8)10-9-6(3)4;/h2*5-6H,1-4H3; |
| InChIKey | UVHUPFRVKQFQJG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.60 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze bis(propan-2-yl 2-methylpropaneperoxoate);zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(propan-2-yl 2-methylpropaneperoxoate);zirconium?
The IUPAC name of bis(propan-2-yl 2-methylpropaneperoxoate);zirconium (CID 88861451) is bis(propan-2-yl 2-methylpropaneperoxoate);zirconium.
What is the SMILES notation for bis(propan-2-yl 2-methylpropaneperoxoate);zirconium?
The canonical SMILES for bis(propan-2-yl 2-methylpropaneperoxoate);zirconium is CC(C)OOC(=O)C(C)C.CC(C)OOC(=O)C(C)C.[Zr].
What is the InChIKey of bis(propan-2-yl 2-methylpropaneperoxoate);zirconium?
The InChIKey is UVHUPFRVKQFQJG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H14O3.Zr/c2*1-5(2)7(8)10-9-6(3)4;/h2*5-6H,1-4H3;.
What are the key properties of bis(propan-2-yl 2-methylpropaneperoxoate);zirconium?
bis(propan-2-yl 2-methylpropaneperoxoate);zirconium has a molecular weight of 383.60 g/mol, XLogP of 3.05, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(propan-2-yl 2-methylpropaneperoxoate);zirconium is sourced from PubChem (CID 88861451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).