About acetyl 2-methylpropaneperoxoate
acetyl 2-methylpropaneperoxoate (PubChem CID 12601440) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is acetyl 2-methylpropaneperoxoate.
Molecular Properties
| Compound Name | acetyl 2-methylpropaneperoxoate |
| PubChem CID | 12601440 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | acetyl 2-methylpropaneperoxoate |
| SMILES | CC(=O)OOC(=O)C(C)C |
| InChI | InChI=1S/C6H10O4/c1-4(2)6(8)10-9-5(3)7/h4H,1-3H3 |
| InChIKey | PYFPOGNWBCNPEO-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze acetyl 2-methylpropaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl 2-methylpropaneperoxoate?
The IUPAC name of acetyl 2-methylpropaneperoxoate (CID 12601440) is acetyl 2-methylpropaneperoxoate.
What is the SMILES notation for acetyl 2-methylpropaneperoxoate?
The canonical SMILES for acetyl 2-methylpropaneperoxoate is CC(=O)OOC(=O)C(C)C.
What is the InChIKey of acetyl 2-methylpropaneperoxoate?
The InChIKey is PYFPOGNWBCNPEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4/c1-4(2)6(8)10-9-5(3)7/h4H,1-3H3.
What are the key properties of acetyl 2-methylpropaneperoxoate?
acetyl 2-methylpropaneperoxoate has a molecular weight of 146.14 g/mol, XLogP of 0.66, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl 2-methylpropaneperoxoate is sourced from PubChem (CID 12601440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).