About tert-butyl 2-methylpropaneperoxoate
tert-butyl 2-methylpropaneperoxoate (PubChem CID 160633746) has the molecular formula C16H32O6
and a molecular weight of 320.43 g/mol. Its IUPAC name is tert-butyl 2-methylpropaneperoxoate.
Molecular Properties
| Compound Name | tert-butyl 2-methylpropaneperoxoate |
| PubChem CID | 160633746 |
| Molecular Formula | C16H32O6 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | tert-butyl 2-methylpropaneperoxoate |
| SMILES | CC(C)C(=O)OOC(C)(C)C.CC(C)C(=O)OOC(C)(C)C |
| InChI | InChI=1S/2C8H16O3/c2*1-6(2)7(9)10-11-8(3,4)5/h2*6H,1-5H3 |
| InChIKey | RIGKCAJKXHJYHQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-methylpropaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-methylpropaneperoxoate?
The IUPAC name of tert-butyl 2-methylpropaneperoxoate (CID 160633746) is tert-butyl 2-methylpropaneperoxoate.
What is the SMILES notation for tert-butyl 2-methylpropaneperoxoate?
The canonical SMILES for tert-butyl 2-methylpropaneperoxoate is CC(C)C(=O)OOC(C)(C)C.CC(C)C(=O)OOC(C)(C)C.
What is the InChIKey of tert-butyl 2-methylpropaneperoxoate?
The InChIKey is RIGKCAJKXHJYHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H16O3/c2*1-6(2)7(9)10-11-8(3,4)5/h2*6H,1-5H3.
What are the key properties of tert-butyl 2-methylpropaneperoxoate?
tert-butyl 2-methylpropaneperoxoate has a molecular weight of 320.43 g/mol, XLogP of 3.83, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-methylpropaneperoxoate is sourced from PubChem (CID 160633746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).