About bis((2-oxo-2-propan-2-ylperoxyethyl) acetate);titanium
bis((2-oxo-2-propan-2-ylperoxyethyl) acetate);titanium (PubChem CID 158036087) has the molecular formula C14H24O10Ti
and a molecular weight of 400.20 g/mol. Its IUPAC name is bis((2-oxo-2-propan-2-ylperoxyethyl) acetate);titanium.
Molecular Properties
| Compound Name | bis((2-oxo-2-propan-2-ylperoxyethyl) acetate);titanium |
| PubChem CID | 158036087 |
| Molecular Formula | C14H24O10Ti |
| Molecular Weight | 400.20 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | bis((2-oxo-2-propan-2-ylperoxyethyl) acetate);titanium |
| SMILES | CC(=O)OCC(=O)OOC(C)C.CC(=O)OCC(=O)OOC(C)C.[Ti] |
| InChI | InChI=1S/2C7H12O5.Ti/c2*1-5(2)11-12-7(9)4-10-6(3)8;/h2*5H,4H2,1-3H3; |
| InChIKey | FHTKCMLKJBUHMQ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze bis((2-oxo-2-propan-2-ylperoxyethyl) acetate);titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((2-oxo-2-propan-2-ylperoxyethyl) acetate);titanium?
The IUPAC name of bis((2-oxo-2-propan-2-ylperoxyethyl) acetate);titanium (CID 158036087) is bis((2-oxo-2-propan-2-ylperoxyethyl) acetate);titanium.
What is the SMILES notation for bis((2-oxo-2-propan-2-ylperoxyethyl) acetate);titanium?
The canonical SMILES for bis((2-oxo-2-propan-2-ylperoxyethyl) acetate);titanium is CC(=O)OCC(=O)OOC(C)C.CC(=O)OCC(=O)OOC(C)C.[Ti].
What is the InChIKey of bis((2-oxo-2-propan-2-ylperoxyethyl) acetate);titanium?
The InChIKey is FHTKCMLKJBUHMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H12O5.Ti/c2*1-5(2)11-12-7(9)4-10-6(3)8;/h2*5H,4H2,1-3H3;.
What are the key properties of bis((2-oxo-2-propan-2-ylperoxyethyl) acetate);titanium?
bis((2-oxo-2-propan-2-ylperoxyethyl) acetate);titanium has a molecular weight of 400.20 g/mol, XLogP of 0.86, 8 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis((2-oxo-2-propan-2-ylperoxyethyl) acetate);titanium is sourced from PubChem (CID 158036087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).