propan-2-yl 2,2-dimethylpropaneperoxoate

C8H16O3 — CID 54308386

IUPACpropan-2-yl 2,2-dimethylpropaneperoxoate
SMILESCC(C)OOC(=O)C(C)(C)C
InChIInChI=1S/C8H16O3/c1-6(2)10-11-7(9)8(3,4)5/h6H,1-5H3
InChIKeySJDLBGRYEFOAJJ-UHFFFAOYSA-N
MW160.21 g/mol
LogP1.92
Rot. Bonds2

About propan-2-yl 2,2-dimethylpropaneperoxoate

propan-2-yl 2,2-dimethylpropaneperoxoate (PubChem CID 54308386) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is propan-2-yl 2,2-dimethylpropaneperoxoate.

Molecular Properties

Compound Namepropan-2-yl 2,2-dimethylpropaneperoxoate
PubChem CID54308386
Molecular FormulaC8H16O3
Molecular Weight160.21 g/mol
Exact Mass160.11
IUPAC Namepropan-2-yl 2,2-dimethylpropaneperoxoate
SMILESCC(C)OOC(=O)C(C)(C)C
InChIInChI=1S/C8H16O3/c1-6(2)10-11-7(9)8(3,4)5/h6H,1-5H3
InChIKeySJDLBGRYEFOAJJ-UHFFFAOYSA-N
XLogP1.92
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.21
LogP ≤ 51.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze propan-2-yl 2,2-dimethylpropaneperoxoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 2,2-dimethylpropaneperoxoate?
The IUPAC name of propan-2-yl 2,2-dimethylpropaneperoxoate (CID 54308386) is propan-2-yl 2,2-dimethylpropaneperoxoate.
What is the SMILES notation for propan-2-yl 2,2-dimethylpropaneperoxoate?
The canonical SMILES for propan-2-yl 2,2-dimethylpropaneperoxoate is CC(C)OOC(=O)C(C)(C)C.
What is the InChIKey of propan-2-yl 2,2-dimethylpropaneperoxoate?
The InChIKey is SJDLBGRYEFOAJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3/c1-6(2)10-11-7(9)8(3,4)5/h6H,1-5H3.
What are the key properties of propan-2-yl 2,2-dimethylpropaneperoxoate?
propan-2-yl 2,2-dimethylpropaneperoxoate has a molecular weight of 160.21 g/mol, XLogP of 1.92, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2,2-dimethylpropaneperoxoate is sourced from PubChem (CID 54308386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).