C11H22O4 — CID 54143217
(4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate (PubChem CID 54143217) has the molecular formula C11H22O4 and a molecular weight of 218.29 g/mol. Its IUPAC name is (4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate.
| Compound Name | (4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate |
|---|---|
| PubChem CID | 54143217 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | (4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate |
| SMILES | CC(O)CC(C)(C)OOC(=O)C(C)(C)C |
| InChI | InChI=1S/C11H22O4/c1-8(12)7-11(5,6)15-14-9(13)10(2,3)4/h8,12H,7H2,1-6H3 |
| InChIKey | OCNODTCSMUUTNC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|