(4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate

C11H22O4 — CID 54143217

IUPAC(4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate
SMILESCC(O)CC(C)(C)OOC(=O)C(C)(C)C
InChIInChI=1S/C11H22O4/c1-8(12)7-11(5,6)15-14-9(13)10(2,3)4/h8,12H,7H2,1-6H3
InChIKeyOCNODTCSMUUTNC-UHFFFAOYSA-N
MW218.29 g/mol
LogP2.06
Rot. Bonds4

About (4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate

(4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate (PubChem CID 54143217) has the molecular formula C11H22O4 and a molecular weight of 218.29 g/mol. Its IUPAC name is (4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate.

Molecular Properties

Compound Name(4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate
PubChem CID54143217
Molecular FormulaC11H22O4
Molecular Weight218.29 g/mol
Exact Mass218.15
IUPAC Name(4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate
SMILESCC(O)CC(C)(C)OOC(=O)C(C)(C)C
InChIInChI=1S/C11H22O4/c1-8(12)7-11(5,6)15-14-9(13)10(2,3)4/h8,12H,7H2,1-6H3
InChIKeyOCNODTCSMUUTNC-UHFFFAOYSA-N
XLogP2.06
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.29
LogP ≤ 52.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze (4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate?
The IUPAC name of (4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate (CID 54143217) is (4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate.
What is the SMILES notation for (4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate?
The canonical SMILES for (4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate is CC(O)CC(C)(C)OOC(=O)C(C)(C)C.
What is the InChIKey of (4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate?
The InChIKey is OCNODTCSMUUTNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O4/c1-8(12)7-11(5,6)15-14-9(13)10(2,3)4/h8,12H,7H2,1-6H3.
What are the key properties of (4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate?
(4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate has a molecular weight of 218.29 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-2-methylpentan-2-yl) 2,2-dimethylpropaneperoxoate is sourced from PubChem (CID 54143217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).