C10H20O7 — CID 54506055
1,3-dihydroxypropan-2-yl (4-hydroxy-2-methylpentan-2-yl)oxy carbonate (PubChem CID 54506055) has the molecular formula C10H20O7 and a molecular weight of 252.26 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl (4-hydroxy-2-methylpentan-2-yl)oxy carbonate.
| Compound Name | 1,3-dihydroxypropan-2-yl (4-hydroxy-2-methylpentan-2-yl)oxy carbonate |
|---|---|
| PubChem CID | 54506055 |
| Molecular Formula | C10H20O7 |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl (4-hydroxy-2-methylpentan-2-yl)oxy carbonate |
| SMILES | CC(O)CC(C)(C)OOC(=O)OC(CO)CO |
| InChI | InChI=1S/C10H20O7/c1-7(13)4-10(2,3)17-16-9(14)15-8(5-11)6-12/h7-8,11-13H,4-6H2,1-3H3 |
| InChIKey | YFUHRTAMZSVBLX-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|