C17H24O8 — CID 54011949
2,3-dihydroxypropyl 2-(4-hydroxy-2-methylpentan-2-yl)peroxycarbonylbenzoate (PubChem CID 54011949) has the molecular formula C17H24O8 and a molecular weight of 356.37 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-(4-hydroxy-2-methylpentan-2-yl)peroxycarbonylbenzoate.
| Compound Name | 2,3-dihydroxypropyl 2-(4-hydroxy-2-methylpentan-2-yl)peroxycarbonylbenzoate |
|---|---|
| PubChem CID | 54011949 |
| Molecular Formula | C17H24O8 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2,3-dihydroxypropyl 2-(4-hydroxy-2-methylpentan-2-yl)peroxycarbonylbenzoate |
| SMILES | CC(O)CC(C)(C)OOC(=O)c1ccccc1C(=O)OCC(O)CO |
| InChI | InChI=1S/C17H24O8/c1-11(19)8-17(2,3)25-24-16(22)14-7-5-4-6-13(14)15(21)23-10-12(20)9-18/h4-7,11-12,18-20H,8-10H2,1-3H3 |
| InChIKey | KSYZABXMYWEPQF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|