C26H42O4 — CID 71346717
bis(3,3,5-trimethylhexyl) benzene-1,2-dicarboxylate (PubChem CID 71346717) has the molecular formula C26H42O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is bis(3,3,5-trimethylhexyl) benzene-1,2-dicarboxylate.
| Compound Name | bis(3,3,5-trimethylhexyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 71346717 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | bis(3,3,5-trimethylhexyl) benzene-1,2-dicarboxylate |
| SMILES | CC(C)CC(C)(C)CCOC(=O)c1ccccc1C(=O)OCCC(C)(C)CC(C)C |
| InChI | InChI=1S/C26H42O4/c1-19(2)17-25(5,6)13-15-29-23(27)21-11-9-10-12-22(21)24(28)30-16-14-26(7,8)18-20(3)4/h9-12,19-20H,13-18H2,1-8H3 |
| InChIKey | YPDKNXPRUMSKTI-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |