C18H26O4S2 — CID 131983572
bis(3-methyl-3-sulfanylbutyl) benzene-1,2-dicarboxylate (PubChem CID 131983572) has the molecular formula C18H26O4S2 and a molecular weight of 370.54 g/mol. Its IUPAC name is bis(3-methyl-3-sulfanylbutyl) benzene-1,2-dicarboxylate.
| Compound Name | bis(3-methyl-3-sulfanylbutyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 131983572 |
| Molecular Formula | C18H26O4S2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | bis(3-methyl-3-sulfanylbutyl) benzene-1,2-dicarboxylate |
| SMILES | CC(C)(S)CCOC(=O)c1ccccc1C(=O)OCCC(C)(C)S |
| InChI | InChI=1S/C18H26O4S2/c1-17(2,23)9-11-21-15(19)13-7-5-6-8-14(13)16(20)22-12-10-18(3,4)24/h5-8,23-24H,9-12H2,1-4H3 |
| InChIKey | MUMYHBPEMKDDEN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|