C19H26O6 — CID 156770973
2-(8-carboxy-8-methylnonoxy)carbonylbenzoic acid (PubChem CID 156770973) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is 2-(8-carboxy-8-methylnonoxy)carbonylbenzoic acid.
| Compound Name | 2-(8-carboxy-8-methylnonoxy)carbonylbenzoic acid |
|---|---|
| PubChem CID | 156770973 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-(8-carboxy-8-methylnonoxy)carbonylbenzoic acid |
| SMILES | CC(C)(CCCCCCCOC(=O)c1ccccc1C(=O)O)C(=O)O |
| InChI | InChI=1S/C19H26O6/c1-19(2,18(23)24)12-8-4-3-5-9-13-25-17(22)15-11-7-6-10-14(15)16(20)21/h6-7,10-11H,3-5,8-9,12-13H2,1-2H3,(H,20,21)(H,23,24) |
| InChIKey | WXSKZULUZWWUGH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|