C26H50O8 — CID 139887865
(2,5-dimethyl-5-octan-2-yloxycarbonylperoxyhexan-2-yl)oxy octan-2-yl carbonate (PubChem CID 139887865) has the molecular formula C26H50O8 and a molecular weight of 490.68 g/mol. Its IUPAC name is (2,5-dimethyl-5-octan-2-yloxycarbonylperoxyhexan-2-yl)oxy octan-2-yl carbonate.
| Compound Name | (2,5-dimethyl-5-octan-2-yloxycarbonylperoxyhexan-2-yl)oxy octan-2-yl carbonate |
|---|---|
| PubChem CID | 139887865 |
| Molecular Formula | C26H50O8 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.35 |
| IUPAC Name | (2,5-dimethyl-5-octan-2-yloxycarbonylperoxyhexan-2-yl)oxy octan-2-yl carbonate |
| SMILES | CCCCCCC(C)OC(=O)OOC(C)(C)CCC(C)(C)OOC(=O)OC(C)CCCCCC |
| InChI | InChI=1S/C26H50O8/c1-9-11-13-15-17-21(3)29-23(27)31-33-25(5,6)19-20-26(7,8)34-32-24(28)30-22(4)18-16-14-12-10-2/h21-22H,9-20H2,1-8H3 |
| InChIKey | CQTXDKLSCDZZQI-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|