About [(2R)-1-hydroxy-4,4-dimethylpentan-2-yl] acetate
[(2R)-1-hydroxy-4,4-dimethylpentan-2-yl] acetate (PubChem CID 11805240) has the molecular formula C9H18O3
and a molecular weight of 174.24 g/mol. Its IUPAC name is [(2R)-1-hydroxy-4,4-dimethylpentan-2-yl] acetate.
Molecular Properties
| Compound Name | [(2R)-1-hydroxy-4,4-dimethylpentan-2-yl] acetate |
| PubChem CID | 11805240 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | [(2R)-1-hydroxy-4,4-dimethylpentan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](CO)CC(C)(C)C |
| InChI | InChI=1S/C9H18O3/c1-7(11)12-8(6-10)5-9(2,3)4/h8,10H,5-6H2,1-4H3/t8-/m1/s1 |
| InChIKey | IQQJQBKQJYMIEW-MRVPVSSYSA-N |
| XLogP | 1.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2R)-1-hydroxy-4,4-dimethylpentan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-hydroxy-4,4-dimethylpentan-2-yl] acetate?
The IUPAC name of [(2R)-1-hydroxy-4,4-dimethylpentan-2-yl] acetate (CID 11805240) is [(2R)-1-hydroxy-4,4-dimethylpentan-2-yl] acetate.
What is the SMILES notation for [(2R)-1-hydroxy-4,4-dimethylpentan-2-yl] acetate?
The canonical SMILES for [(2R)-1-hydroxy-4,4-dimethylpentan-2-yl] acetate is CC(=O)O[C@@H](CO)CC(C)(C)C.
What is the InChIKey of [(2R)-1-hydroxy-4,4-dimethylpentan-2-yl] acetate?
The InChIKey is IQQJQBKQJYMIEW-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H18O3/c1-7(11)12-8(6-10)5-9(2,3)4/h8,10H,5-6H2,1-4H3/t8-/m1/s1.
What are the key properties of [(2R)-1-hydroxy-4,4-dimethylpentan-2-yl] acetate?
[(2R)-1-hydroxy-4,4-dimethylpentan-2-yl] acetate has a molecular weight of 174.24 g/mol, XLogP of 1.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-hydroxy-4,4-dimethylpentan-2-yl] acetate is sourced from PubChem (CID 11805240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).