C13H28O2 — CID 168837690
2-(2,2,6,6-tetramethylheptan-4-yloxy)ethanol (PubChem CID 168837690) has the molecular formula C13H28O2 and a molecular weight of 216.36 g/mol. Its IUPAC name is 2-(2,2,6,6-tetramethylheptan-4-yloxy)ethanol.
| Compound Name | 2-(2,2,6,6-tetramethylheptan-4-yloxy)ethanol |
|---|---|
| PubChem CID | 168837690 |
| Molecular Formula | C13H28O2 |
| Molecular Weight | 216.36 g/mol |
| Exact Mass | 216.21 |
| IUPAC Name | 2-(2,2,6,6-tetramethylheptan-4-yloxy)ethanol |
| SMILES | CC(C)(C)CC(CC(C)(C)C)OCCO |
| InChI | InChI=1S/C13H28O2/c1-12(2,3)9-11(15-8-7-14)10-13(4,5)6/h11,14H,7-10H2,1-6H3 |
| InChIKey | PDGCLZSGZPOWLO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |