C17H34O5 — CID 102394219
(5-tert-butylperoxy-2,5-dimethylhexan-2-yl) 2,2-dimethylpropaneperoxoate (PubChem CID 102394219) has the molecular formula C17H34O5 and a molecular weight of 318.45 g/mol. Its IUPAC name is (5-tert-butylperoxy-2,5-dimethylhexan-2-yl) 2,2-dimethylpropaneperoxoate.
| Compound Name | (5-tert-butylperoxy-2,5-dimethylhexan-2-yl) 2,2-dimethylpropaneperoxoate |
|---|---|
| PubChem CID | 102394219 |
| Molecular Formula | C17H34O5 |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | (5-tert-butylperoxy-2,5-dimethylhexan-2-yl) 2,2-dimethylpropaneperoxoate |
| SMILES | CC(C)(C)OOC(C)(C)CCC(C)(C)OOC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H34O5/c1-14(2,3)13(18)19-21-16(7,8)11-12-17(9,10)22-20-15(4,5)6/h11-12H2,1-10H3 |
| InChIKey | MECKJLQGNUTQJP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|