C23H46O8 — CID 87844016
(2-methylpropan-2-yl)oxy 7,7-dimethyloctaneperoxoate;(2-methylpropan-2-yl)oxy 2,2-dimethylpropaneperoxoate (PubChem CID 87844016) has the molecular formula C23H46O8 and a molecular weight of 450.61 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxy 7,7-dimethyloctaneperoxoate;(2-methylpropan-2-yl)oxy 2,2-dimethylpropaneperoxoate.
| Compound Name | (2-methylpropan-2-yl)oxy 7,7-dimethyloctaneperoxoate;(2-methylpropan-2-yl)oxy 2,2-dimethylpropaneperoxoate |
|---|---|
| PubChem CID | 87844016 |
| Molecular Formula | C23H46O8 |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | (2-methylpropan-2-yl)oxy 7,7-dimethyloctaneperoxoate;(2-methylpropan-2-yl)oxy 2,2-dimethylpropaneperoxoate |
| SMILES | CC(C)(C)CCCCCC(=O)OOOC(C)(C)C.CC(C)(C)OOOC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H28O4.C9H18O4/c1-13(2,3)11-9-7-8-10-12(15)16-18-17-14(4,5)6;1-8(2,3)7(10)11-13-12-9(4,5)6/h7-11H2,1-6H3;1-6H3 |
| InChIKey | ADRXPGZTCXOJSE-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|