C18H36O3 — CID 87560828
2,3,3-trimethylpentan-2-yl 7,7-dimethyloctaneperoxoate (PubChem CID 87560828) has the molecular formula C18H36O3 and a molecular weight of 300.48 g/mol. Its IUPAC name is 2,3,3-trimethylpentan-2-yl 7,7-dimethyloctaneperoxoate.
| Compound Name | 2,3,3-trimethylpentan-2-yl 7,7-dimethyloctaneperoxoate |
|---|---|
| PubChem CID | 87560828 |
| Molecular Formula | C18H36O3 |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | 2,3,3-trimethylpentan-2-yl 7,7-dimethyloctaneperoxoate |
| SMILES | CCC(C)(C)C(C)(C)OOC(=O)CCCCCC(C)(C)C |
| InChI | InChI=1S/C18H36O3/c1-9-17(5,6)18(7,8)21-20-15(19)13-11-10-12-14-16(2,3)4/h9-14H2,1-8H3 |
| InChIKey | LTKRLZOWPZIKOF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|