C18H38O4 — CID 19866769
2,7-bis(tert-butylperoxy)-2,7-dimethyloctane (PubChem CID 19866769) has the molecular formula C18H38O4 and a molecular weight of 318.50 g/mol. Its IUPAC name is 2,7-bis(tert-butylperoxy)-2,7-dimethyloctane.
| Compound Name | 2,7-bis(tert-butylperoxy)-2,7-dimethyloctane |
|---|---|
| PubChem CID | 19866769 |
| Molecular Formula | C18H38O4 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.28 |
| IUPAC Name | 2,7-bis(tert-butylperoxy)-2,7-dimethyloctane |
| SMILES | CC(C)(C)OOC(C)(C)CCCCC(C)(C)OOC(C)(C)C |
| InChI | InChI=1S/C18H38O4/c1-15(2,3)19-21-17(7,8)13-11-12-14-18(9,10)22-20-16(4,5)6/h11-14H2,1-10H3 |
| InChIKey | GZDSMDYFJVYTTC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|