C19H40O4 — CID 175767272
2,5-bis(tert-butylperoxy)-2,5,7-trimethyloctane (PubChem CID 175767272) has the molecular formula C19H40O4 and a molecular weight of 332.53 g/mol. Its IUPAC name is 2,5-bis(tert-butylperoxy)-2,5,7-trimethyloctane.
| Compound Name | 2,5-bis(tert-butylperoxy)-2,5,7-trimethyloctane |
|---|---|
| PubChem CID | 175767272 |
| Molecular Formula | C19H40O4 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.29 |
| IUPAC Name | 2,5-bis(tert-butylperoxy)-2,5,7-trimethyloctane |
| SMILES | CC(C)CC(C)(CCC(C)(C)OOC(C)(C)C)OOC(C)(C)C |
| InChI | InChI=1S/C19H40O4/c1-15(2)14-19(11,23-21-17(6,7)8)13-12-18(9,10)22-20-16(3,4)5/h15H,12-14H2,1-11H3 |
| InChIKey | AHGRMAQRQSYHTK-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|