C26H50O6 — CID 162512300
[2,5-dimethyl-5-(3,3,5-trimethylhexanoylperoxy)hexan-2-yl] 3,3,5-trimethylhexaneperoxoate (PubChem CID 162512300) has the molecular formula C26H50O6 and a molecular weight of 458.68 g/mol. Its IUPAC name is [2,5-dimethyl-5-(3,3,5-trimethylhexanoylperoxy)hexan-2-yl] 3,3,5-trimethylhexaneperoxoate.
| Compound Name | [2,5-dimethyl-5-(3,3,5-trimethylhexanoylperoxy)hexan-2-yl] 3,3,5-trimethylhexaneperoxoate |
|---|---|
| PubChem CID | 162512300 |
| Molecular Formula | C26H50O6 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.36 |
| IUPAC Name | [2,5-dimethyl-5-(3,3,5-trimethylhexanoylperoxy)hexan-2-yl] 3,3,5-trimethylhexaneperoxoate |
| SMILES | CC(C)CC(C)(C)CC(=O)OOC(C)(C)CCC(C)(C)OOC(=O)CC(C)(C)CC(C)C |
| InChI | InChI=1S/C26H50O6/c1-19(2)15-23(5,6)17-21(27)29-31-25(9,10)13-14-26(11,12)32-30-22(28)18-24(7,8)16-20(3)4/h19-20H,13-18H2,1-12H3 |
| InChIKey | OPNTVGKYGRQPKE-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|