C13H32N2O — CID 177024213
ethane;methanamine;N,3,3,5-tetramethylhexanamide (PubChem CID 177024213) has the molecular formula C13H32N2O and a molecular weight of 232.41 g/mol. Its IUPAC name is ethane;methanamine;N,3,3,5-tetramethylhexanamide.
| Compound Name | ethane;methanamine;N,3,3,5-tetramethylhexanamide |
|---|---|
| PubChem CID | 177024213 |
| Molecular Formula | C13H32N2O |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.25 |
| IUPAC Name | ethane;methanamine;N,3,3,5-tetramethylhexanamide |
| SMILES | CC.CN.CNC(=O)CC(C)(C)CC(C)C |
| InChI | InChI=1S/C10H21NO.C2H6.CH5N/c1-8(2)6-10(3,4)7-9(12)11-5;2*1-2/h8H,6-7H2,1-5H3,(H,11,12);1-2H3;2H2,1H3 |
| InChIKey | GSNSQLMWWSSWDT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |