C12H27NO — CID 177048526
ethane;3-ethyl-N,5-dimethylhexanamide (PubChem CID 177048526) has the molecular formula C12H27NO and a molecular weight of 201.35 g/mol. Its IUPAC name is ethane;3-ethyl-N,5-dimethylhexanamide.
| Compound Name | ethane;3-ethyl-N,5-dimethylhexanamide |
|---|---|
| PubChem CID | 177048526 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | ethane;3-ethyl-N,5-dimethylhexanamide |
| SMILES | CC.CCC(CC(=O)NC)CC(C)C |
| InChI | InChI=1S/C10H21NO.C2H6/c1-5-9(6-8(2)3)7-10(12)11-4;1-2/h8-9H,5-7H2,1-4H3,(H,11,12);1-2H3 |
| InChIKey | BNZRGSKLIFIZMA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |