C11H22N2O3 — CID 141238561
3-(2-methoxypropyl)-N,N'-dimethylpentanediamide (PubChem CID 141238561) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-(2-methoxypropyl)-N,N'-dimethylpentanediamide.
| Compound Name | 3-(2-methoxypropyl)-N,N'-dimethylpentanediamide |
|---|---|
| PubChem CID | 141238561 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 3-(2-methoxypropyl)-N,N'-dimethylpentanediamide |
| SMILES | CNC(=O)CC(CC(=O)NC)CC(C)OC |
| InChI | InChI=1S/C11H22N2O3/c1-8(16-4)5-9(6-10(14)12-2)7-11(15)13-3/h8-9H,5-7H2,1-4H3,(H,12,14)(H,13,15) |
| InChIKey | GAPBIMPGHKEOBU-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |