C7H14N2O2 — CID 87931486
(3R)-3-acetamido-N-methylbutanamide (PubChem CID 87931486) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is (3R)-3-acetamido-N-methylbutanamide.
| Compound Name | (3R)-3-acetamido-N-methylbutanamide |
|---|---|
| PubChem CID | 87931486 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | (3R)-3-acetamido-N-methylbutanamide |
| SMILES | CNC(=O)C[C@@H](C)NC(C)=O |
| InChI | InChI=1S/C7H14N2O2/c1-5(9-6(2)10)4-7(11)8-3/h5H,4H2,1-3H3,(H,8,11)(H,9,10)/t5-/m1/s1 |
| InChIKey | LGCCARKYQGNJMX-RXMQYKEDSA-N |
| XLogP | -0.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |