C13H26N2O2 — CID 144964928
(5S)-5-acetamido-N-methyl-4-methylidenehexanamide;propane (PubChem CID 144964928) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is (5S)-5-acetamido-N-methyl-4-methylidenehexanamide;propane.
| Compound Name | (5S)-5-acetamido-N-methyl-4-methylidenehexanamide;propane |
|---|---|
| PubChem CID | 144964928 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | (5S)-5-acetamido-N-methyl-4-methylidenehexanamide;propane |
| SMILES | C=C(CCC(=O)NC)[C@H](C)NC(C)=O.CCC |
| InChI | InChI=1S/C10H18N2O2.C3H8/c1-7(5-6-10(14)11-4)8(2)12-9(3)13;1-3-2/h8H,1,5-6H2,2-4H3,(H,11,14)(H,12,13);3H2,1-2H3/t8-;/m0./s1 |
| InChIKey | UAOVDLUYMNVUHJ-QRPNPIFTSA-N |
| XLogP | 2.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|