C6H14N2O — CID 88935703
N-[(2R)-1-(methylamino)propan-2-yl]acetamide (PubChem CID 88935703) has the molecular formula C6H14N2O and a molecular weight of 130.19 g/mol. Its IUPAC name is N-[(2R)-1-(methylamino)propan-2-yl]acetamide.
| Compound Name | N-[(2R)-1-(methylamino)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 88935703 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | N-[(2R)-1-(methylamino)propan-2-yl]acetamide |
| SMILES | CNC[C@@H](C)NC(C)=O |
| InChI | InChI=1S/C6H14N2O/c1-5(4-7-3)8-6(2)9/h5,7H,4H2,1-3H3,(H,8,9)/t5-/m1/s1 |
| InChIKey | JNHAUFFZNTYUQV-RXMQYKEDSA-N |
| XLogP | -0.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |