C8H19N3O2 — CID 163940153
N-[(2S)-2-hydroxy-2-[[(2S)-1-(methylamino)propan-2-yl]amino]ethyl]acetamide (PubChem CID 163940153) has the molecular formula C8H19N3O2 and a molecular weight of 189.26 g/mol. Its IUPAC name is N-[(2S)-2-hydroxy-2-[[(2S)-1-(methylamino)propan-2-yl]amino]ethyl]acetamide.
| Compound Name | N-[(2S)-2-hydroxy-2-[[(2S)-1-(methylamino)propan-2-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 163940153 |
| Molecular Formula | C8H19N3O2 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | N-[(2S)-2-hydroxy-2-[[(2S)-1-(methylamino)propan-2-yl]amino]ethyl]acetamide |
| SMILES | CNC[C@H](C)N[C@@H](O)CNC(C)=O |
| InChI | InChI=1S/C8H19N3O2/c1-6(4-9-3)11-8(13)5-10-7(2)12/h6,8-9,11,13H,4-5H2,1-3H3,(H,10,12)/t6-,8-/m0/s1 |
| InChIKey | RQHHGCXFFZKYEG-XPUUQOCRSA-N |
| XLogP | -1.36 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|