C10H23NO2V — CID 177155626
ethane;3-hydroxy-N,5-dimethylhexanamide;vanadium (PubChem CID 177155626) has the molecular formula C10H23NO2V and a molecular weight of 240.24 g/mol. Its IUPAC name is ethane;3-hydroxy-N,5-dimethylhexanamide;vanadium.
| Compound Name | ethane;3-hydroxy-N,5-dimethylhexanamide;vanadium |
|---|---|
| PubChem CID | 177155626 |
| Molecular Formula | C10H23NO2V |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | ethane;3-hydroxy-N,5-dimethylhexanamide;vanadium |
| SMILES | CC.CNC(=O)CC(O)CC(C)C.[V] |
| InChI | InChI=1S/C8H17NO2.C2H6.V/c1-6(2)4-7(10)5-8(11)9-3;1-2;/h6-7,10H,4-5H2,1-3H3,(H,9,11);1-2H3; |
| InChIKey | IOBNYUYJZOSDSW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |