C6H13NOS — CID 58528328
(3S)-N-methyl-3-methylsulfanylbutanamide (PubChem CID 58528328) has the molecular formula C6H13NOS and a molecular weight of 147.24 g/mol. Its IUPAC name is (3S)-N-methyl-3-methylsulfanylbutanamide.
| Compound Name | (3S)-N-methyl-3-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 58528328 |
| Molecular Formula | C6H13NOS |
| Molecular Weight | 147.24 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | (3S)-N-methyl-3-methylsulfanylbutanamide |
| SMILES | CNC(=O)C[C@H](C)SC |
| InChI | InChI=1S/C6H13NOS/c1-5(9-3)4-6(8)7-2/h5H,4H2,1-3H3,(H,7,8)/t5-/m0/s1 |
| InChIKey | NUFMUDKUTILHFC-YFKPBYRVSA-N |
| XLogP | 0.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |