C10H22N2O2S — CID 115894341
3-[(1-hydroxy-4-methylsulfanylbutan-2-yl)amino]-N-methylbutanamide (PubChem CID 115894341) has the molecular formula C10H22N2O2S and a molecular weight of 234.36 g/mol. Its IUPAC name is 3-[(1-hydroxy-4-methylsulfanylbutan-2-yl)amino]-N-methylbutanamide.
| Compound Name | 3-[(1-hydroxy-4-methylsulfanylbutan-2-yl)amino]-N-methylbutanamide |
|---|---|
| PubChem CID | 115894341 |
| Molecular Formula | C10H22N2O2S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 3-[(1-hydroxy-4-methylsulfanylbutan-2-yl)amino]-N-methylbutanamide |
| SMILES | CNC(=O)CC(C)NC(CO)CCSC |
| InChI | InChI=1S/C10H22N2O2S/c1-8(6-10(14)11-2)12-9(7-13)4-5-15-3/h8-9,12-13H,4-7H2,1-3H3,(H,11,14) |
| InChIKey | BCERHGMRBTXVKM-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |