C17H29NO2S — CID 46986938
2-(1-adamantyl)-N-[(2S)-1-hydroxy-4-methylsulfanylbutan-2-yl]acetamide (PubChem CID 46986938) has the molecular formula C17H29NO2S and a molecular weight of 311.49 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[(2S)-1-hydroxy-4-methylsulfanylbutan-2-yl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[(2S)-1-hydroxy-4-methylsulfanylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 46986938 |
| Molecular Formula | C17H29NO2S |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-(1-adamantyl)-N-[(2S)-1-hydroxy-4-methylsulfanylbutan-2-yl]acetamide |
| SMILES | CSCC[C@@H](CO)NC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H29NO2S/c1-21-3-2-15(11-19)18-16(20)10-17-7-12-4-13(8-17)6-14(5-12)9-17/h12-15,19H,2-11H2,1H3,(H,18,20)/t12?,13?,14?,15-,17?/m0/s1 |
| InChIKey | UAXDJRGKXGIKFV-RDVIWEACSA-N |
| XLogP | 2.82 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |