C17H25NO5 — CID 75257795
2-[[2-(1-adamantyl)acetyl]amino]pentanedioic acid (PubChem CID 75257795) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-[[2-(1-adamantyl)acetyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-(1-adamantyl)acetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 75257795 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-[[2-(1-adamantyl)acetyl]amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)CC12CC3CC(CC(C3)C1)C2)C(=O)O |
| InChI | InChI=1S/C17H25NO5/c19-14(18-13(16(22)23)1-2-15(20)21)9-17-6-10-3-11(7-17)5-12(4-10)8-17/h10-13H,1-9H2,(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | CTUVATLHXUAZGQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |