C15H23NO4 — CID 51885575
(2R)-2-[[2-(1-adamantyl)acetyl]amino]-3-hydroxypropanoic acid (PubChem CID 51885575) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is (2R)-2-[[2-(1-adamantyl)acetyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[[2-(1-adamantyl)acetyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 51885575 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (2R)-2-[[2-(1-adamantyl)acetyl]amino]-3-hydroxypropanoic acid |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C15H23NO4/c17-8-12(14(19)20)16-13(18)7-15-4-9-1-10(5-15)3-11(2-9)6-15/h9-12,17H,1-8H2,(H,16,18)(H,19,20)/t9?,10?,11?,12-,15?/m1/s1 |
| InChIKey | CPQREZQJIQHREM-RDZWNTDESA-N |
| XLogP | 1.15 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |