C21H29NO2 — CID 46997008
2-(1-adamantyl)-N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]acetamide (PubChem CID 46997008) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 46997008 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 2-(1-adamantyl)-N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)N[C@@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C21H29NO2/c23-14-19(9-15-4-2-1-3-5-15)22-20(24)13-21-10-16-6-17(11-21)8-18(7-16)12-21/h1-5,16-19,23H,6-14H2,(H,22,24)/t16?,17?,18?,19-,21?/m1/s1 |
| InChIKey | YTUIRZCBDUNAQP-VJJCQHNBSA-N |
| XLogP | 3.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |