C6H13NO3S — CID 89486760
(1-hydroxy-4-methylsulfanylbutan-2-yl)carbamic acid (PubChem CID 89486760) has the molecular formula C6H13NO3S and a molecular weight of 179.24 g/mol. Its IUPAC name is (1-hydroxy-4-methylsulfanylbutan-2-yl)carbamic acid.
| Compound Name | (1-hydroxy-4-methylsulfanylbutan-2-yl)carbamic acid |
|---|---|
| PubChem CID | 89486760 |
| Molecular Formula | C6H13NO3S |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | (1-hydroxy-4-methylsulfanylbutan-2-yl)carbamic acid |
| SMILES | CSCCC(CO)NC(=O)O |
| InChI | InChI=1S/C6H13NO3S/c1-11-3-2-5(4-8)7-6(9)10/h5,7-8H,2-4H2,1H3,(H,9,10) |
| InChIKey | NVKIOJSRKLGQOZ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |