C6H11NO2S — CID 130374131
N-methyl-4-oxo-3-sulfanylpentanamide (PubChem CID 130374131) has the molecular formula C6H11NO2S and a molecular weight of 161.23 g/mol. Its IUPAC name is N-methyl-4-oxo-3-sulfanylpentanamide.
| Compound Name | N-methyl-4-oxo-3-sulfanylpentanamide |
|---|---|
| PubChem CID | 130374131 |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | N-methyl-4-oxo-3-sulfanylpentanamide |
| SMILES | CNC(=O)CC(S)C(C)=O |
| InChI | InChI=1S/C6H11NO2S/c1-4(8)5(10)3-6(9)7-2/h5,10H,3H2,1-2H3,(H,7,9) |
| InChIKey | PDCJVLRGIORRHJ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|