C13H28N2O2 — CID 156649253
ethane;N,N',2,2,4-pentamethylhexanediamide (PubChem CID 156649253) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is ethane;N,N',2,2,4-pentamethylhexanediamide.
| Compound Name | ethane;N,N',2,2,4-pentamethylhexanediamide |
|---|---|
| PubChem CID | 156649253 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | ethane;N,N',2,2,4-pentamethylhexanediamide |
| SMILES | CC.CNC(=O)CC(C)CC(C)(C)C(=O)NC |
| InChI | InChI=1S/C11H22N2O2.C2H6/c1-8(6-9(14)12-4)7-11(2,3)10(15)13-5;1-2/h8H,6-7H2,1-5H3,(H,12,14)(H,13,15);1-2H3 |
| InChIKey | BOCQMZZIZOXKMP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |