C15H33NO2 — CID 145078832
N,3-dimethyl-4-oxobutanamide;ethane;2,2,3-trimethylbutane (PubChem CID 145078832) has the molecular formula C15H33NO2 and a molecular weight of 259.43 g/mol. Its IUPAC name is N,3-dimethyl-4-oxobutanamide;ethane;2,2,3-trimethylbutane.
| Compound Name | N,3-dimethyl-4-oxobutanamide;ethane;2,2,3-trimethylbutane |
|---|---|
| PubChem CID | 145078832 |
| Molecular Formula | C15H33NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | N,3-dimethyl-4-oxobutanamide;ethane;2,2,3-trimethylbutane |
| SMILES | CC.CC(C)C(C)(C)C.CNC(=O)CC(C)C=O |
| InChI | InChI=1S/C7H16.C6H11NO2.C2H6/c1-6(2)7(3,4)5;1-5(4-8)3-6(9)7-2;1-2/h6H,1-5H3;4-5H,3H2,1-2H3,(H,7,9);1-2H3 |
| InChIKey | BROYFYCAAGXCBA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|