C13H27NO — CID 144600492
ethane;(E)-N,3,4-trimethyloct-6-enamide (PubChem CID 144600492) has the molecular formula C13H27NO and a molecular weight of 213.37 g/mol. Its IUPAC name is ethane;(E)-N,3,4-trimethyloct-6-enamide.
| Compound Name | ethane;(E)-N,3,4-trimethyloct-6-enamide |
|---|---|
| PubChem CID | 144600492 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | ethane;(E)-N,3,4-trimethyloct-6-enamide |
| SMILES | C/C=C/CC(C)C(C)CC(=O)NC.CC |
| InChI | InChI=1S/C11H21NO.C2H6/c1-5-6-7-9(2)10(3)8-11(13)12-4;1-2/h5-6,9-10H,7-8H2,1-4H3,(H,12,13);1-2H3/b6-5+; |
| InChIKey | VJXGKORNINMEBQ-IPZCTEOASA-N |
| XLogP | 3.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|